![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1979-12 Byte Magazine December 1979.pdf | 2012-08-30 21:47 | 285M | |
| 1979-07 Byte Magazine July 1979.pdf | 2012-08-30 21:44 | 276M | |
| 1978-12 Byte Magazine Deceber 1978.pdf | 2012-08-30 20:43 | 232M | |
| 1980-04 Vol 05-04 Printed Software.pdf | 2011-03-23 15:07 | 195M | |
| 1980-03 Vol 05-03 Computers in the Labratory.pdf | 2011-03-19 13:06 | 191M | |
| 1978-05 Byte Magazine May 1978.pdf | 2012-08-30 19:59 | 189M | |
| 1979-05 Vol 04-05 Computer Generated Maps.pdf | 2011-06-06 03:34 | 175M | |
| 1980-02 Vol 05-02 Graph Theory.pdf | 2011-03-19 08:32 | 175M | |
| 1980-01 Vol 05-01 Domesticated Computers.pdf | 2011-03-20 23:11 | 174M | |
| 1977-07 Byte Magazine July 1977.pdf | 2012-08-30 19:47 | 166M | |
| 1979-01 Vol 04-01 Life Algorithms.pdf | 2011-03-19 03:55 | 144M | |
| 1979-02 Vol 04-02 Robot Arm.pdf | 2011-03-23 14:45 | 143M | |
| 1980-09 Vol 05-09 Homebrewing.pdf | 2012-08-30 12:37 | 136M | |
| 1978-02 Vol 03-02 Hardware Projects.pdf | 2011-03-19 00:23 | 131M | |
| 1978-06 Vol 03-06 Natural Language.pdf | 2011-06-06 03:26 | 127M | |
| 1977-10 Vol 02-10 Implementing Space War.pdf | 2011-03-18 21:55 | 126M | |
| 1978-08 Vol 03-08 Pascal.pdf | 2011-03-19 00:19 | 122M | |
| 1978-01 Vol 03-01 The Brains of Men and Machines.pdf | 2011-03-18 23:35 | 116M | |
| 1977-05 Vol 02-05 Interfacing.pdf | 2011-06-06 03:20 | 105M | |
| 1977-04 Vol 02-04 Baudot Machines.pdf | 2011-03-18 23:13 | 104M | |
| 1980-06 Vol 05-06 Inter Computer Communications.pdf | 2012-08-30 12:28 | 99M | |
| 1976-10 Vol 00-14 Ham Radio.pdf | 2011-03-18 21:17 | 83M | |
| 1976-12 Vol 00-16 Machine Readable Print.pdf | 2011-03-18 21:20 | 83M | |
| 1976-08 Vol 00-12 Speech Synthesis.pdf | 2011-03-18 20:02 | 73M | |
| 1975-12 Vol 00-04 Assembling an Altair.pdf | 2011-03-18 19:45 | 65M | |
| 1976-03 Vol 00-07 Cassette Interfaces.pdf | 2011-03-18 19:53 | 54M | |
| 1977-03 Vol 02-03.pdf | 2012-08-30 13:34 | 46M | |
| 1976-05 Vol 00-09 Shooting Stars.pdf | 2011-06-03 08:02 | 26M | |
| 1981-02 Vol 06-02 The Computer and Voice Synthesis.pdf | 2020-03-17 19:03 | 7.7M | |
| 1981-06 Vol 06-06 Operating Systems.pdf | 2020-03-17 19:03 | 6.9M | |
| 1975-11 Vol 00-03 Is This Next.pdf | 2017-04-14 01:55 | 4.8M | |
| 1975-10 Vol 00-02 Build a Graphics Display.pdf | 2017-04-14 01:55 | 3.3M | |
| 1980-12 Vol 05-12 Adventure.pdf | 2020-03-17 19:02 | 2.8M | |
|
|---|